| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-21 15:17:23 UTC |
|---|
| Update Date | 2025-03-25 01:00:04 UTC |
|---|
| HMDB ID | HMDB0038902 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02240982 |
|---|
| Name | Lupiwighteone |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H18O5 |
|---|
| Molecular Mass | 338.1154 |
|---|
| SMILES | CC(C)=CCc1c(O)cc(O)c2c(=O)c(-c3ccc(O)cc3)coc12 |
|---|
| InChI Key | YGCCASGFIOIXIN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | isoflav-2-enes |
|---|
| Direct Parent | isoflavones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzene and substituted derivativeschromonesheteroaromatic compoundshydrocarbon derivativesisoflavonoidsorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivativesvinylogous acids |
|---|
| Substituents | isoflavonemonocyclic benzene moietybenzopyran1-benzopyranheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidoxacyclevinylogous acidorganic oxideorganic oxygen compoundchromonearomatic heteropolycyclic compoundpyranpyranonephenolhydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
|---|
