| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:17:24 UTC |
|---|
| Update Date | 2025-03-25 01:00:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02241002 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H11Cl3O3 |
|---|
| Molecular Mass | 247.9774 |
|---|
| SMILES | CC(C)C(=O)OC(CO)C(Cl)(Cl)Cl |
|---|
| InChI Key | KHDYZFXNMASYKR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | carboxylic acid derivatives |
|---|
| Direct Parent | carboxylic acid esters |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl chloridescarbonyl compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganochloridesprimary alcohols |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl groupalkyl chlorideorganochlorideorganohalogen compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esteralkyl halidehydrocarbon derivativeprimary alcoholorganooxygen compound |
|---|