| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:17:31 UTC |
|---|
| Update Date | 2025-03-25 01:00:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02241283 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H29N3O7 |
|---|
| Molecular Mass | 363.2006 |
|---|
| SMILES | CC(=O)NCCCNCCCCNC(=O)C1OC(O)C(O)C(O)C1O |
|---|
| InChI Key | CXCCZXDUJNZRHE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyran carboxylic acids and derivatives |
|---|
| Direct Parent | pyran carboxylic acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesamino acids and derivativescarbonyl compoundscarboxylic acids and derivativesdialkylamineshemiacetalshydrocarbon derivativesmonosaccharidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanespyranssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupamino acid or derivativesmonosaccharidecarboxylic acid derivativesaccharideorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneacetamidealcoholsecondary aliphatic aminepyran carboxylic acid or derivativessecondary aminecarboxamide groupoxacyclesecondary carboxylic acid amideorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundamine |
|---|