| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:17:31 UTC |
|---|
| Update Date | 2025-03-25 01:00:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02241290 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H24N2O6 |
|---|
| Molecular Mass | 340.1634 |
|---|
| SMILES | CC(=O)NCCc1ccc(NC2C(O)OC(CO)C(O)C2O)cc1 |
|---|
| InChI Key | KFCIQOXBISEGRS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | amines |
|---|
| Direct Parent | phenylalkylamines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesamino acids and derivativesbenzene and substituted derivativescarbonyl compoundscarboxylic acids and derivativeshemiacetalshydrocarbon derivativesmonosaccharidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary alkylarylaminessecondary carboxylic acid amides |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compoundamino acid or derivativesmonosaccharidecarboxylic acid derivativesaccharideorganic oxideorganopnictogen compoundhemiacetaloxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholsecondary aminecarboxamide groupsecondary aliphatic/aromatic amineoxacyclesecondary carboxylic acid amideorganic oxygen compoundsecondary alcoholphenylalkylaminehydrocarbon derivativebenzenoidorganooxygen compound |
|---|