| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:17:33 UTC |
|---|
| Update Date | 2025-03-25 01:00:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02241381 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H17NO8 |
|---|
| Molecular Mass | 315.0954 |
|---|
| SMILES | CC(NCC(O)COC(=O)c1cc(O)c(O)c(O)c1)C(=O)O |
|---|
| InChI Key | JENWCEHWIZDDMA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | m-hydroxybenzoic acid esters |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalanine and derivativesalpha amino acidsamino acidsbenzoyl derivativescarbonyl compoundscarboxylic acid esterscarboxylic acidsdialkylaminesdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganopnictogen compoundspyrogallols and derivativessecondary alcoholsp-hydroxybenzoic acid alkyl esters |
|---|
| Substituents | carbonyl groupcarboxylic acidamino acid or derivativesamino acidp-hydroxybenzoic acid esterbenzoyl1-hydroxy-2-unsubstituted benzenoidalpha-amino acid or derivativescarboxylic acid derivativeorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundm-hydroxybenzoic acid esteralcoholsecondary aliphatic aminepyrogallol derivativebenzenetriol1-hydroxy-4-unsubstituted benzenoidsecondary aminep-hydroxybenzoic acid alkyl esteraromatic homomonocyclic compoundorganic oxygen compoundcarboxylic acid estersecondary alcoholdicarboxylic acid or derivativesalanine or derivativesphenolhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundamine |
|---|