| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:17:34 UTC |
|---|
| Update Date | 2025-03-25 01:00:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02241393 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H11O9P |
|---|
| Molecular Mass | 258.0141 |
|---|
| SMILES | CC(O)(COP(=O)(O)O)C(=O)C(O)C(=O)O |
|---|
| InChI Key | WIHYEGYSAVASHP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | keto acids and derivatives |
|---|
| Subclass | short-chain keto acids and derivatives |
|---|
| Direct Parent | short-chain keto acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 1,3-dicarbonyl compoundsacyloinsalpha hydroxy acids and derivativesalpha-hydroxy ketonesbeta-hydroxy ketonesbeta-keto acids and derivativescarboxylic acidshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidessecondary alcoholstertiary alcohols |
|---|
| Substituents | beta-hydroxy ketonealiphatic acyclic compoundcarbonyl groupcarboxylic acidalpha-hydroxy acidmonosaccharideshort-chain keto acidalpha-hydroxy ketonecarboxylic acid derivativebeta-keto acidketonesaccharideorganic oxidealcoholhydroxy acidtertiary alcoholmonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid estermonoalkyl phosphateacyloinsecondary alcoholhydrocarbon derivative1,3-dicarbonyl compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
