| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:17:34 UTC |
|---|
| Update Date | 2025-03-25 01:00:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02241402 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H13NO5 |
|---|
| Molecular Mass | 203.0794 |
|---|
| SMILES | CC(O)(CC=O)CC(O)=NCC(=O)O |
|---|
| InChI Key | JKOKIQLJIVXIPX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha-hydrogen aldehydesbeta-hydroxy aldehydescarboximidic acidscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspropargyl-type 1,3-dipolar organic compoundstertiary alcohols |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarboximidic acidbeta-hydroxy aldehydecarbonyl groupcarboxylic acidaldehydeorganic 1,3-dipolar compoundpropargyl-type 1,3-dipolar organic compoundtertiary alcoholorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundalpha-hydrogen aldehydeorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
