| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:17:35 UTC |
|---|
| Update Date | 2025-03-25 01:00:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02241460 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H25N3O4 |
|---|
| Molecular Mass | 275.1845 |
|---|
| SMILES | CC(O)C(N)C(=O)N1CCN(CCOCCO)CC1 |
|---|
| InChI Key | WEXKKCDFSOSHLN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acid amides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkyl ethershydrocarbon derivativesmonoalkylaminesn-alkylpiperazinesorganic oxidesorganopnictogen compoundssecondary alcoholstertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | carbonyl groupetherdialkyl etherorganic oxidepiperazinetertiary carboxylic acid amidealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundtertiary amineorganoheterocyclic compoundalcoholalpha-amino acid amideazacyclen-alkylpiperazinetertiary aliphatic aminecarboxamide grouporganic oxygen compound1,4-diazinanesecondary alcoholhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundamineorganooxygen compound |
|---|