| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:17:39 UTC |
|---|
| Update Date | 2025-03-25 01:00:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02241584 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H23NO7P+ |
|---|
| Molecular Mass | 300.1207 |
|---|
| SMILES | CC(CO)(COP(=O)(O)OCC[N+](C)(C)C)C(=O)O |
|---|
| InChI Key | IKZJTAUZWSBZNC-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | quaternary ammonium salts |
|---|
| Direct Parent | phosphocholines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsaminesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdialkyl phosphateshydrocarbon derivativesmonocarboxylic acids and derivativesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundstetraalkylammonium salts |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidcarboxylic acid derivativebeta-hydroxy acidorganic oxideorganopnictogen compoundorganic cationorganic saltalcoholtetraalkylammonium salthydroxy acidphosphocholinedialkyl phosphatemonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid esterhydrocarbon derivativeorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|
