| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:17:40 UTC |
|---|
| Update Date | 2025-03-25 01:00:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02241656 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H19N3O3 |
|---|
| Molecular Mass | 229.1426 |
|---|
| SMILES | CC(N)C(=O)N1CCN(C(C)C(=O)O)CC1 |
|---|
| InChI Key | ALUGKEAIFUOPPR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acid amides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alanine and derivativesalpha amino acidsamino acidsazacyclic compoundscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesn-alkylpiperazinesorganic oxidesorganopnictogen compoundstertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | carbonyl groupcarboxylic acidamino acidorganic oxidepiperazinetertiary carboxylic acid amidealiphatic heteromonocyclic compoundalpha-amino acidorganonitrogen compoundorganopnictogen compoundtertiary amineorganoheterocyclic compoundalpha-amino acid amideazacyclen-alkylpiperazinetertiary aliphatic aminecarboxamide groupmonocarboxylic acid or derivativesorganic oxygen compound1,4-diazinanealanine or derivativeshydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundamineorganooxygen compound |
|---|
