| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:17:43 UTC |
|---|
| Update Date | 2025-03-25 01:00:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02241748 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H9O8P |
|---|
| Molecular Mass | 240.0035 |
|---|
| SMILES | CC1(C(=O)O)OC2COP(=O)(O)OC2O1 |
|---|
| InChI Key | LJDUKQINGWPRAE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | ethers |
|---|
| Direct Parent | ketals |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,3-dioxolanescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesoxacyclic compounds |
|---|
| Substituents | meta-dioxolanecarbonyl groupcarboxylic acidcarboxylic acid derivativealiphatic heteropolycyclic compoundoxacycleorganic oxidemonocarboxylic acid or derivativesketalhydrocarbon derivativeorganic phosphoric acid derivativeorganoheterocyclic compound |
|---|
