| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:17:49 UTC |
|---|
| Update Date | 2025-03-25 01:00:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02242000 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H19N3O5 |
|---|
| Molecular Mass | 285.1325 |
|---|
| SMILES | CC(C)CC1N=C(O)C(CC(N)=O)C(C(=O)O)N=C1O |
|---|
| InChI Key | URCIQLFUVHDVMO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | cyclic peptides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,4-diazepinesalpha amino acidsazacyclic compoundscarbonyl compoundscarboxylic acidscyclic carboximidic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary carboxylic acid amidespropargyl-type 1,3-dipolar organic compounds |
|---|
| Substituents | primary carboxylic acid amidecarbonyl groupcarboxylic acidazacycleorganic 1,3-dipolar compoundalpha-amino acid or derivativescarboxamide grouppropargyl-type 1,3-dipolar organic compoundorganic oxidemonocarboxylic acid or derivativespara-diazepineorganic oxygen compoundcyclic alpha peptidealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundcyclic carboximidic acidorganoheterocyclic compoundorganooxygen compound |
|---|
