| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:17:51 UTC |
|---|
| Update Date | 2025-03-25 01:00:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02242065 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H28N3O4+ |
|---|
| Molecular Mass | 302.2074 |
|---|
| SMILES | CC(C)CC(C(=O)NC(=O)CCC(N)C(=O)O)[N+](C)(C)C |
|---|
| InChI Key | MUNCLLIAHWVQKN-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamine and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acidsaminesbranched fatty acidscarbonyl compoundscarboxylic acidsdicarboximideshydrocarbon derivativesleucine and derivativesmonoalkylaminesmonocarboxylic acids and derivativesn-acyl aminesn-unsubstituted carboxylic acid imidesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundstetraalkylammonium salts |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acidglutamine or derivativesfatty acidcarboxylic acid imide, n-unsubstitutedorganic oxideleucine or derivativesorganonitrogen compoundalpha-amino acidorganopnictogen compounddicarboximideorganic cationorganic salttetraalkylammonium saltquaternary ammonium saltbranched fatty acidn-acyl-aminecarboxylic acid imidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundamineorganooxygen compound |
|---|
