| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:17:53 UTC |
|---|
| Update Date | 2025-03-25 01:00:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02242163 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H24NO+ |
|---|
| Molecular Mass | 186.1852 |
|---|
| SMILES | CC(C1(O)CCCCC1)[N+](C)(C)C |
|---|
| InChI Key | IQRRVBQXPCXTLX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcoholsaminescyclic alcohols and derivativeshydrocarbon derivativesorganic cationsorganic saltsorganopnictogen compoundstertiary alcoholstetraalkylammonium salts |
|---|
| Substituents | tetraalkylammonium salt1,2-aminoalcoholquaternary ammonium saltcyclohexanolcyclic alcoholtertiary alcoholorganonitrogen compoundaliphatic homomonocyclic compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic cationorganic saltamine |
|---|
