| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:17:55 UTC |
|---|
| Update Date | 2025-03-25 01:00:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02242217 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C26H43NO6 |
|---|
| Molecular Mass | 465.309 |
|---|
| SMILES | CC(CCC(=O)NCC(=O)O)C1CCC2C3CC(O)C4(C)CCC(O)CC4C3CC(O)C12C |
|---|
| InChI Key | PTUZDAUFKOCAAG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | steroids and steroid derivatives |
|---|
| Subclass | pregnane steroids |
|---|
| Direct Parent | pregnane steroids |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | 12-hydroxysteroids6-hydroxysteroidsacyl glycinesalpha amino acidscarbonyl compoundscarboxylic acidscyclic alcohols and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesn-acyl aminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | fatty acylcarbonyl group12-hydroxysteroidcarboxylic acidfatty amidealpha-amino acid or derivativescarboxylic acid derivativealiphatic homopolycyclic compoundorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundn-acyl-alpha amino acid or derivativesalcoholn-acyl-alpha-amino acidhydroxysteroidcyclic alcoholcarboxamide groupn-acyl-aminen-acylglycinesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compound2-hydroxysteroidsecondary alcoholhydrocarbon derivative6-hydroxysteroidorganic nitrogen compoundpregnane-skeletonorganooxygen compound |
|---|
