| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:17:57 UTC |
|---|
| Update Date | 2025-03-25 01:00:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02242289 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H23NO3 |
|---|
| Molecular Mass | 325.1678 |
|---|
| SMILES | CC(C)NCC(O)COc1cc2ccccc2c2ccc(O)cc12 |
|---|
| InChI Key | FHXCWTMVLZKIAN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrols |
|---|
| Direct Parent | phenanthrols |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersdialkylamineshydrocarbon derivativesnaphthols and derivativesorganopnictogen compoundsphenol etherssecondary alcohols |
|---|
| Substituents | alcoholphenol ethersecondary aliphatic amineetherphenanthrol1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compoundalkyl aryl ethersecondary aminenaphthaleneorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compound2-naphtholorganooxygen compoundamine |
|---|
