| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:18:07 UTC |
|---|
| Update Date | 2025-03-25 01:00:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02242675 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H30N4O3 |
|---|
| Molecular Mass | 398.2318 |
|---|
| SMILES | CC(=O)N1CCN(c2ccc(OCC3CCCC(Cn4ccnc4)O3)cc2)CC1 |
|---|
| InChI Key | HWGZERURMJPHTM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazinanes |
|---|
| Subclass | piperazines |
|---|
| Direct Parent | phenylpiperazines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesalkyl aryl ethersamino acids and derivativesaminophenyl ethersaniline and substituted anilinesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkyl ethersdialkylarylaminesheteroaromatic compoundshydrocarbon derivativesimidazolesn-arylpiperazinesn-substituted imidazolesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesphenoxy compoundstertiary carboxylic acid amides |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupetheraromatic heteromonocyclic compoundamino acid or derivativesalkyl aryl ethercarboxylic acid derivativedialkyl etherorganic oxideimidazoletertiary aliphatic/aromatic aminetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundoxanedialkylarylamineaminophenyl ethertertiary amineacetamideazolen-substituted imidazoleazacycleaniline or substituted anilinesheteroaromatic compoundcarboxamide groupphenylpiperazineoxacycleorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundaminen-arylpiperazineorganooxygen compound |
|---|