| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:18:07 UTC |
|---|
| Update Date | 2025-03-25 01:00:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02242688 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H18N2O2 |
|---|
| Molecular Mass | 234.1368 |
|---|
| SMILES | CC(=O)N1CCN(c2ccc(CO)cc2)CC1 |
|---|
| InChI Key | DCRLFTXMPHKOFH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazinanes |
|---|
| Subclass | piperazines |
|---|
| Direct Parent | phenylpiperazines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesamino acids and derivativesaniline and substituted anilinesaromatic alcoholsazacyclic compoundsbenzyl alcoholscarbonyl compoundscarboxylic acids and derivativesdialkylarylamineshydrocarbon derivativesn-arylpiperazinesorganic oxidesorganopnictogen compoundstertiary carboxylic acid amides |
|---|
| Substituents | aromatic alcoholmonocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compoundamino acid or derivativescarboxylic acid derivativeorganic oxidetertiary aliphatic/aromatic aminetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compounddialkylarylaminetertiary amineacetamidealcoholazacycleaniline or substituted anilinesbenzyl alcoholcarboxamide groupphenylpiperazineorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundaminen-arylpiperazineorganooxygen compound |
|---|
