| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:18:07 UTC |
|---|
| Update Date | 2025-03-25 01:00:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02242689 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H24N2O |
|---|
| Molecular Mass | 308.1889 |
|---|
| SMILES | CC(=O)N1CCN(c2ccc(Cc3ccc(C)cc3)cc2)CC1 |
|---|
| InChI Key | ZYNCFNPJFVMHLW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesamino acids and derivativesaniline and substituted anilinesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkylarylamineshydrocarbon derivativesn-arylpiperazinesorganic oxidesorganopnictogen compoundsphenylpiperazinestertiary carboxylic acid amidestoluenes |
|---|
| Substituents | diphenylmethanecarbonyl grouparomatic heteromonocyclic compoundamino acid or derivativescarboxylic acid derivativeorganic oxidepiperazinetertiary aliphatic/aromatic aminetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compounddialkylarylaminetertiary amineorganoheterocyclic compoundacetamideazacycleaniline or substituted anilinescarboxamide groupphenylpiperazineorganic oxygen compound1,4-diazinanehydrocarbon derivativeorganic nitrogen compoundtolueneaminen-arylpiperazineorganooxygen compound |
|---|
