| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:18:08 UTC |
|---|
| Update Date | 2025-03-25 01:00:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02242706 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H12O3 |
|---|
| Molecular Mass | 204.0786 |
|---|
| SMILES | CC(=O)C(O)C(C=O)=Cc1ccccc1 |
|---|
| InChI Key | NPYBPQQVUIMDGM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamaldehydes |
|---|
| Subclass | cinnamaldehydes |
|---|
| Direct Parent | cinnamaldehydes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acyloinsalpha-hydroxy ketonesbenzene and substituted derivativesbeta-hydroxy aldehydescinnamyl alcoholshydrocarbon derivativesorganic oxidessecondary alcohols |
|---|
| Substituents | alcoholmonocyclic benzene moietycinnamaldehydecarbonyl groupbeta-hydroxy aldehydecinnamyl alcoholaldehydealpha-hydroxy ketoneketonearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundacyloinsecondary alcoholhydrocarbon derivativebenzenoidorganooxygen compound |
|---|