| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:18:08 UTC |
|---|
| Update Date | 2025-03-25 01:00:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02242720 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H7N5O |
|---|
| Molecular Mass | 177.0651 |
|---|
| SMILES | C=Nc1nc(=O)c2c(ncn2C)[nH]1 |
|---|
| InChI Key | UVEBBRXEVZMZQA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | hypoxanthines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesiminesn-substituted imidazolesorganic oxidesorganooxygen compoundsorganopnictogen compoundspropargyl-type 1,3-dipolar organic compoundspurines and purine derivativespyrimidonesvinylogous amides |
|---|
| Substituents | vinylogous amideazacycleimineheteroaromatic compoundpyrimidoneorganic 1,3-dipolar compoundpyrimidinepropargyl-type 1,3-dipolar organic compoundorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundhypoxanthinehydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundazolen-substituted imidazole |
|---|
