| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:18:11 UTC |
|---|
| Update Date | 2025-03-25 01:00:28 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02242812 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H6Cl3O5P |
|---|
| Molecular Mass | 269.9018 |
|---|
| SMILES | C=C(OP(=O)(O)O)C(O)C(Cl)(Cl)Cl |
|---|
| InChI Key | BMTPNOHIBOGOIJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | phosphate esters |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl chlorideschlorohydrinshydrocarbon derivativesorganic oxidesorganochloridessecondary alcohols |
|---|
| Substituents | alcoholaliphatic acyclic compoundchlorohydrinhalohydrinalkyl chlorideorganochlorideorganohalogen compoundorganic oxideorganic oxygen compoundphosphoric acid estersecondary alcoholalkyl halidehydrocarbon derivativeorganooxygen compound |
|---|
