| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:18:16 UTC |
|---|
| Update Date | 2025-03-25 01:00:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02243029 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H14N2O2 |
|---|
| Molecular Mass | 242.1055 |
|---|
| SMILES | C=CC1=C(C)C(C(=O)c2ccccc2N)NC1=O |
|---|
| InChI Key | XKFJSQJVSYHLBT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | alkyl-phenylketones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesaryl alkyl ketonesazacyclic compoundsbenzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativeslactamsorganic oxidesorganopnictogen compoundsprimary aminespyrroline carboxylic acids and derivativessecondary carboxylic acid amidesvinylogous amides |
|---|
| Substituents | monocyclic benzene moietylactamaryl alkyl ketonearomatic heteromonocyclic compoundamino acid or derivativesbenzoylcarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundvinylogous amideazacyclepyrroline carboxylic acid or derivativescarboxamide groupsecondary carboxylic acid amidepyrrolinehydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundaminealkyl-phenylketone |
|---|