| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:18:29 UTC |
|---|
| Update Date | 2025-03-25 01:00:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02243530 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H19NO5 |
|---|
| Molecular Mass | 245.1263 |
|---|
| SMILES | CC(=O)NC1C(O)C(O)CC2OC(C)(C)OC21 |
|---|
| InChI Key | SDKTZMNTFXGQAQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | ethers |
|---|
| Direct Parent | ketals |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diols1,3-dioxolanesacetamidescarbonyl compoundscarboxylic acids and derivativescyclic alcohols and derivativeshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | alcoholmeta-dioxolanecarbonyl groupcyclic alcoholcarboxamide groupcarboxylic acid derivativealiphatic heteropolycyclic compoundoxacyclesecondary carboxylic acid amideorganic oxideketalorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganoheterocyclic compoundacetamide1,2-diol |
|---|