| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:18:38 UTC |
|---|
| Update Date | 2025-03-25 01:00:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02243917 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H35O5PS |
|---|
| Molecular Mass | 394.1943 |
|---|
| SMILES | CCCCCCC=CCCCCCCCC(=O)SCCOP(=O)(O)O |
|---|
| InChI Key | IBHYUFKGDWALBV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acyl thioesters |
|---|
| Direct Parent | fatty acyl thioesters |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarbothioic s-esterscarboxylic acids and derivativeshydrocarbon derivativesmonoalkyl phosphatesorganic oxidessulfenyl compoundsthioestersthiolactones |
|---|
| Substituents | aliphatic acyclic compoundthiocarboxylic acid or derivativescarbonyl groupsulfenyl compoundthiocarboxylic acid esterorganosulfur compoundcarboxylic acid derivativecarbothioic s-esterorganic oxideorganic oxygen compoundphosphoric acid estermonoalkyl phosphatehydrocarbon derivativefatty acyl thioesterthiolactoneorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
