| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:18:41 UTC |
|---|
| Update Date | 2025-03-25 01:00:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02244023 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C31H58N2O7P+ |
|---|
| Molecular Mass | 601.3976 |
|---|
| SMILES | CCCCCC=CCC=CCC=CCCCCCCCC(=O)NC(CCC(=O)O)COP(=O)(O)OCC[N+](C)(C)C |
|---|
| InChI Key | ZBKAIQQBCFGMOD-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | gamma amino acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | aminescarbonyl compoundscarboxylic acidsdialkyl phosphateshydrocarbon derivativesmonocarboxylic acids and derivativesn-acyl aminesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundsphosphocholinesphosphoethanolaminessecondary carboxylic acid amidesshort-chain hydroxy acids and derivativestetraalkylammonium salts |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acidshort-chain hydroxy acidgamma amino acid or derivativesfatty amidephosphoethanolamineorganic oxideorganonitrogen compoundorganopnictogen compoundorganic cationorganic salttetraalkylammonium saltquaternary ammonium saltcarboxamide groupn-acyl-aminephosphocholinesecondary carboxylic acid amidedialkyl phosphatemonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid esterhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|