| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:18:54 UTC |
|---|
| Update Date | 2025-03-25 01:00:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02244542 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H19NO6 |
|---|
| Molecular Mass | 273.1212 |
|---|
| SMILES | CCCCCC=C(O)C(O)=NOC(=O)CCC(=O)O |
|---|
| InChI Key | PKACNLHKACVINR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | hydroxy acids and derivatives |
|---|
| Subclass | short-chain hydroxy acids and derivatives |
|---|
| Direct Parent | short-chain hydroxy acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acid saltscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganic saltsorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidshort-chain hydroxy acidcarboxylic acid derivativeorganic oxideorganic oxygen compoundorganonitrogen compounddicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic saltcarboxylic acid saltorganooxygen compound |
|---|
