| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:19:00 UTC |
|---|
| Update Date | 2025-03-25 01:00:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02244778 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H16N4O3 |
|---|
| Molecular Mass | 216.1222 |
|---|
| SMILES | CN(C)C(=N)NC(=N)CCC(O)C(=O)O |
|---|
| InChI Key | COMYQANPORABGQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | delta amino acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesamidinescarbonyl compoundscarboximidamidescarboxylic acidsguanidineshydrocarbon derivativeshydroxy fatty acidsiminesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganopnictogen compoundssecondary alcoholsshort-chain hydroxy acids and derivatives |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acidshort-chain hydroxy acidguanidineiminealpha-hydroxy acidmonosaccharidefatty acidamidinesaccharideorganic oxideorganonitrogen compoundorganopnictogen compounddelta amino acid or derivativeshydroxy fatty acidalcoholcarboximidamidehydroxy acidmonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|