| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:19:00 UTC |
|---|
| Update Date | 2025-03-25 01:00:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02244788 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H4F17NO4S |
|---|
| Molecular Mass | 556.959 |
|---|
| SMILES | CN(C(=O)O)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
| InChI Key | ZXILPXSMBXNVSL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organohalogen compounds |
|---|
| Class | alkyl halides |
|---|
| Subclass | alkyl fluorides |
|---|
| Direct Parent | perfluorooctane sulfonic acid and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesaminosulfonyl compoundscarbonyl compoundshydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganofluoridesorganonitrogen compoundsorganopnictogen compoundsorganosulfonic acids and derivatives |
|---|
| Substituents | aliphatic acyclic compoundperfluorooctane sulfonic acid or derivativesorganosulfonic acid or derivativescarbonyl groupcarbonic acid derivativeaminosulfonyl compoundorganofluorideorganosulfur compoundorganic oxidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativesorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
