| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:19:02 UTC |
|---|
| Update Date | 2025-03-25 01:00:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02244838 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H16O4 |
|---|
| Molecular Mass | 296.1049 |
|---|
| SMILES | CCc1oc2cc(O)ccc2c(=O)c1-c1ccc(OC)cc1 |
|---|
| InChI Key | ZONADXWKVZSVHF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | isoflav-2-enes |
|---|
| Direct Parent | isoflavones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersanisoleschromonesheteroaromatic compoundshydrocarbon derivativesisoflavonoidsmethoxybenzenesorganic oxidesoxacyclic compoundsphenoxy compoundspyranones and derivatives |
|---|
| Substituents | phenol ethermonocyclic benzene moietyether1-benzopyran1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundisoflavonebenzopyranheteroaromatic compoundmethoxybenzeneoxacycleorganic oxygen compoundpyrananisolehydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compound |
|---|