| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:19:02 UTC |
|---|
| Update Date | 2025-03-25 01:00:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02244871 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H18N2O |
|---|
| Molecular Mass | 254.1419 |
|---|
| SMILES | CN(C)CCc1c[nH]c2cc3c(O)cccc3cc12 |
|---|
| InChI Key | MBSMXFLAGDAFRY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthols and derivatives |
|---|
| Direct Parent | naphthols and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesindolesorganooxygen compoundsorganopnictogen compoundspyrrolestrialkylamines |
|---|
| Substituents | azacycleindoleheteroaromatic compoundtertiary aliphatic amine1-hydroxy-2-unsubstituted benzenoidindole or derivatives1-hydroxy-4-unsubstituted benzenoidorganic oxygen compoundaromatic heteropolycyclic compoundpyrroleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivative1-naphtholorganic nitrogen compoundaminetertiary amineorganoheterocyclic compoundorganooxygen compound |
|---|
