| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:19:03 UTC |
|---|
| Update Date | 2025-03-25 01:00:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02244882 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H24N2O9 |
|---|
| Molecular Mass | 412.1482 |
|---|
| SMILES | CN(C)CCC(=O)c1cc(OC2OC(C(=O)O)C(O)C(O)C2O)ccc1NC=O |
|---|
| InChI Key | WBHUNYNVPJDCQX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsalkyl-phenylketonesamino acidsanilidesaryl alkyl ketonesbenzoyl derivativesbeta hydroxy acids and derivativesbeta-amino ketonescarboxylic acidsglucuronic acid derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesn-arylamidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesphenol ethersphenoxy compoundspyran carboxylic acidssecondary alcoholssecondary carboxylic acid amidestrialkylaminesvinylogous amides |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarboxylic acidaryl alkyl ketoneamino acid or derivativesbenzoylo-glucuronidemonosaccharidepyran carboxylic acidketone1-o-glucuronidebeta-hydroxy acidacetalorganonitrogen compoundoxanebeta-aminoketoneorganoheterocyclic compoundalcoholvinylogous amidetertiary aliphatic aminephenylketonesecondary carboxylic acid amidehydrocarbon derivativephenoxy compoundaminealkyl-phenylketonearyl ketonecarbonyl grouparomatic heteromonocyclic compoundamino acidn-arylamidecarboxylic acid derivativeorganic oxideorganopnictogen compoundtertiary aminepyran carboxylic acid or derivativeshydroxy acidcarboxamide groupanilideoxacyclemonocarboxylic acid or derivativespyransecondary alcoholbenzenoidorganic nitrogen compound |
|---|