| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:19:03 UTC |
|---|
| Update Date | 2025-03-25 01:00:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02244903 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H25NO3 |
|---|
| Molecular Mass | 279.1834 |
|---|
| SMILES | CN(C)CCC(CO)c1ccc(C(C)(C)C(=O)O)cc1 |
|---|
| InChI Key | BVBZHNDUZAJNSG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | prenol lipids |
|---|
| Subclass | monoterpenoids |
|---|
| Direct Parent | aromatic monoterpenoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | amino acidscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesmonocyclic monoterpenoidsorganic oxidesorganopnictogen compoundsphenylpropanesprimary alcoholstrialkylamines |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupmonocyclic monoterpenoidcarboxylic acidamino acid or derivativesamino acidp-cymenecarboxylic acid derivativephenylpropaneorganic oxideorganonitrogen compoundorganopnictogen compoundprimary alcoholtertiary aminealcoholtertiary aliphatic aminearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compoundaromatic monoterpenoid |
|---|
