| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:19:03 UTC |
|---|
| Update Date | 2025-03-25 01:00:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02244905 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H15N2O7P |
|---|
| Molecular Mass | 318.0617 |
|---|
| SMILES | CCOP(=O)(NC(C)C(=O)O)Oc1ccc([N+](=O)[O-])cc1 |
|---|
| InChI Key | QWHNEFFODUZDTK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alanine and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesnitroaromatic compoundsnitrobenzenesorganic oxidesorganic oxoanionic compoundsorganic oxoazanium compoundsorganic phosphoramidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundsphosphoric diester monoamidespropargyl-type 1,3-dipolar organic compounds |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidallyl-type 1,3-dipolar organic compoundorganic nitro compoundpropargyl-type 1,3-dipolar organic compoundorganic oxidec-nitro compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganic oxoazaniumphosphoric diester monoamideorganic phosphoric acid amidenitrobenzenenitroaromatic compoundorganic 1,3-dipolar compoundaromatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid esteralanine or derivativeshydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundorganic phosphoric acid derivativeorganooxygen compoundorganic hyponitrite |
|---|