| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:19:04 UTC |
|---|
| Update Date | 2025-03-25 01:00:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02244931 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H29N4O9P |
|---|
| Molecular Mass | 512.1672 |
|---|
| SMILES | CCOP(=O)(OCC)OCC(O)C(O)C(O)Cn1c2nc(=O)[nH]c(=O)c-2nc2cc(C)c(C)cc21 |
|---|
| InChI Key | VYUVOKHDGAGQCX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | flavin nucleotides |
|---|
| Subclass | flavin nucleotides |
|---|
| Direct Parent | flavin nucleotides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzenoidsdiazanaphthalenesflavinsheteroaromatic compoundshydrocarbon derivativeslactamsorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrazinespyrimidonesquinoxalinessecondary alcoholstrialkyl phosphates |
|---|
| Substituents | lactamtrialkyl phosphatepyrimidonepteridineisoalloxazineflavinpyrimidineorganic oxidediazanaphthalenearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundalcoholquinoxalinecarbonic acid derivativeazacycleflavin nucleotideheteroaromatic compoundorganic oxygen compoundphosphoric acid esterpyrazinesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
