| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:19:04 UTC |
|---|
| Update Date | 2025-03-25 01:00:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02244934 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H25NO4P+ |
|---|
| Molecular Mass | 302.1516 |
|---|
| SMILES | CCOP(=O)(O)Oc1ccc(CC(C)[N+](C)(C)C)cc1 |
|---|
| InChI Key | KRZGHBUTJRQTNW-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenethylamines |
|---|
| Direct Parent | amphetamines and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | amineshydrocarbon derivativesmonoalkyl phosphatesorganic cationsorganic oxidesorganic saltsorganooxygen compoundsorganopnictogen compoundsphenoxy compoundsphenylpropanestetraalkylammonium salts |
|---|
| Substituents | tetraalkylammonium saltquaternary ammonium saltphenylpropanearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundphosphoric acid estermonoalkyl phosphateorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic cationphenoxy compoundorganic saltorganic phosphoric acid derivativeaminealkyl phosphateamphetamine or derivativesorganooxygen compound |
|---|
