| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:19:07 UTC |
|---|
| Update Date | 2025-03-25 01:00:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02245060 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H24N4O2 |
|---|
| Molecular Mass | 328.1899 |
|---|
| SMILES | CN1CCN(Cc2ccc(Cn3cncc3CC(=O)O)cc2)CC1 |
|---|
| InChI Key | GABYNTJVMKOCTL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylmethylamines |
|---|
| Direct Parent | phenylmethylamines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amino acidsaralkylaminesazacyclic compoundsbenzylaminescarbonyl compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesimidazolesmonocarboxylic acids and derivativesn-methylpiperazinesn-substituted imidazolesorganic oxidesorganopnictogen compoundstrialkylamines |
|---|
| Substituents | carbonyl groupcarboxylic acidaromatic heteromonocyclic compoundamino acid or derivativesamino acidcarboxylic acid derivativearalkylamineorganic oxidepiperazineimidazoleorganonitrogen compoundorganopnictogen compoundtertiary amineorganoheterocyclic compoundazolen-substituted imidazoleazacyclen-alkylpiperazineheteroaromatic compoundtertiary aliphatic aminen-methylpiperazinemonocarboxylic acid or derivativesphenylmethylamineorganic oxygen compoundbenzylamine1,4-diazinanehydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
