| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:19:10 UTC |
|---|
| Update Date | 2025-03-25 01:00:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02245188 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H14N6O |
|---|
| Molecular Mass | 282.1229 |
|---|
| SMILES | CN(C)c1nc(=O)c2c(N)nc(-c3ccccc3)nc2[nH]1 |
|---|
| InChI Key | BQCCMNDBWOFHQE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | amines |
|---|
| Direct Parent | dialkylarylamines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aminopyrimidines and derivativesazacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminespyrimidonesvinylogous amides |
|---|
| Substituents | vinylogous amidemonocyclic benzene moietyazacycleheteroaromatic compoundpyrimidonepyrimidineaminopyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundorganopnictogen compoundhydrocarbon derivativebenzenoidprimary aminedialkylarylamineimidolactamorganoheterocyclic compoundorganooxygen compound |
|---|