| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:19:11 UTC |
|---|
| Update Date | 2025-03-25 01:00:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02245217 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H15ClN2O |
|---|
| Molecular Mass | 286.0873 |
|---|
| SMILES | CN1CC(c2ccccc2)(c2ccc(Cl)cc2)N=C1O |
|---|
| InChI Key | JCXJELSDMXWYNB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aryl chloridesazacyclic compoundscarbonyl compoundschlorobenzeneshydrocarbon derivativesimidazolidinonesorganic carbonic acids and derivativesorganic oxidesorganochloridesorganonitrogen compoundsorganopnictogen compoundsphenylimidazolidines |
|---|
| Substituents | imidazolidinediphenylmethanecarbonyl groupphenylimidazolidinearomatic heteromonocyclic compoundorganochlorideorganohalogen compoundimidazolidinoneorganic oxideorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundaryl chloridechlorobenzenecarbonic acid derivativeazacyclearyl halideorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|
