| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:19:12 UTC |
|---|
| Update Date | 2025-03-25 01:00:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02245244 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H9ClN2OS |
|---|
| Molecular Mass | 240.0124 |
|---|
| SMILES | CN1C(=O)CSC1=Nc1ccc(Cl)cc1 |
|---|
| InChI Key | LELKGRZPMDCDAX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | halobenzenes |
|---|
| Direct Parent | chlorobenzenes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aryl chloridesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesisothioureasorganic oxidesorganochloridesorganonitrogen compoundsorganopnictogen compoundspropargyl-type 1,3-dipolar organic compoundsthiazolidines |
|---|
| Substituents | carbonyl grouparomatic heteromonocyclic compoundorganochloridecarboxylic acid derivativeorganohalogen compoundpropargyl-type 1,3-dipolar organic compoundorganic oxideorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundisothioureaaryl chloridechlorobenzeneazacycleorganic 1,3-dipolar compoundaryl halideorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundthiazolidine |
|---|