| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:19:12 UTC |
|---|
| Update Date | 2025-03-25 01:00:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02245253 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H11FN2O2 |
|---|
| Molecular Mass | 210.0805 |
|---|
| SMILES | CN1C(=O)C(O)CC1c1ccc(F)cn1 |
|---|
| InChI Key | BMKGKBSAIQXGNV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridines and derivatives |
|---|
| Subclass | halopyridines |
|---|
| Direct Parent | polyhalopyridines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesaryl fluoridesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativeshydroxypyridineslactamsmethylpyridinesn-alkylpyrrolidinesorganic oxidesorganofluoridesorganonitrogen compoundsorganopnictogen compoundspyrrolidine-2-onessecondary alcoholstertiary carboxylic acid amides |
|---|
| Substituents | aryl fluoride2-pyrrolidonecarbonyl grouplactamaromatic heteromonocyclic compoundpolyhalopyridinecarboxylic acid derivativeorganohalogen compoundorganic oxidetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compound2-halopyridinepyrrolidinepyrrolidonealcoholazacyclen-alkylpyrrolidineorganofluorideheteroaromatic compoundhydroxypyridinemethylpyridinecarboxamide grouparyl halideorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
