| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:19:12 UTC |
|---|
| Update Date | 2025-03-25 01:00:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02245260 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H18N2O3S |
|---|
| Molecular Mass | 270.1038 |
|---|
| SMILES | CN1C(=O)C2CSC(CCCCC(N)=O)C2C1=O |
|---|
| InChI Key | DOBDVFDLZWIIQH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | carboxylic acid derivatives |
|---|
| Direct Parent | n-substituted carboxylic acid imides |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkylthioethersdicarboximidesfatty amideshydrocarbon derivativesn-alkylpyrrolidinesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary carboxylic acid amidespyrrolidine-2-onesthiolanes |
|---|
| Substituents | thiolaneprimary carboxylic acid amidefatty acyl2-pyrrolidonecarbonyl groupfatty amidealiphatic heteropolycyclic compoundorganic oxideorganonitrogen compoundorganopnictogen compounddicarboximidepyrrolidinecarboxylic acid imide, n-substitutedpyrrolidoneorganoheterocyclic compoundazacyclen-alkylpyrrolidinedialkylthioethercarboxamide grouporganic oxygen compoundthioetherhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|