| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:19:14 UTC |
|---|
| Update Date | 2025-03-25 01:00:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02245324 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C24H36N2O2S |
|---|
| Molecular Mass | 416.2497 |
|---|
| SMILES | CCCCCCCCc1ccc(NCc2ccc(CSCCNC(C)=O)o2)cc1 |
|---|
| InChI Key | RSOFPJCQFQOCMI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | amines |
|---|
| Direct Parent | phenylalkylamines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesamino acids and derivativesbenzene and substituted derivativescarbonyl compoundscarboxylic acids and derivativesdialkylthioethersfuransheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundssecondary alkylarylaminessecondary carboxylic acid amidessulfenyl compounds |
|---|
| Substituents | furanmonocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compoundamino acid or derivativesorganosulfur compoundcarboxylic acid derivativeorganic oxideorganopnictogen compoundorganoheterocyclic compoundacetamidesulfenyl compounddialkylthioetherheteroaromatic compoundsecondary aminecarboxamide groupsecondary aliphatic/aromatic amineoxacyclesecondary carboxylic acid amideorganic oxygen compoundthioetherphenylalkylaminehydrocarbon derivativebenzenoidorganooxygen compound |
|---|
