| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:19:20 UTC |
|---|
| Update Date | 2025-03-25 01:00:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02245571 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C38H48N4O8 |
|---|
| Molecular Mass | 688.3472 |
|---|
| SMILES | CCOC(=O)CCc1c2[nH]c(c1C)Cc1[nH]c(c(C)c1CCC(=O)O)Cc1[nH]c(c(C)c1CCC(=O)O)Cc1[nH]c(c(C)c1CCC(=O)O)C2 |
|---|
| InChI Key | AIEFTAGLHLWITK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | tetrapyrroles and derivatives |
|---|
| Subclass | metallotetrapyrroles |
|---|
| Direct Parent | metalloporphyrins |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acid esterscarboxylic acidsfatty acid estersheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsporphyrinspyrrolestetracarboxylic acids and derivatives |
|---|
| Substituents | fatty acylcarbonyl groupporphyrincarboxylic acidazacycleheteroaromatic compoundtetracarboxylic acid or derivativescarboxylic acid derivativefatty acid esterorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundcarboxylic acid esterpyrroleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundmetalloporphyrin |
|---|