| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:19:22 UTC |
|---|
| Update Date | 2025-03-25 01:00:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02245641 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H23NO2 |
|---|
| Molecular Mass | 249.1729 |
|---|
| SMILES | CCCCCCOC(=O)Nc1c(C)cccc1C |
|---|
| InChI Key | KIZBGVYGFKJSCS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylcarbamic acid esters |
|---|
| Direct Parent | phenylcarbamic acid esters |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | carbamate esterscarbonyl compoundshydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsm-xylenes |
|---|
| Substituents | carbonyl groupcarbonic acid derivativem-xylenecarbamic acid esteraromatic homomonocyclic compoundxyleneorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativephenylcarbamic acid esterorganic nitrogen compoundorganooxygen compound |
|---|
