| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:19:25 UTC |
|---|
| Update Date | 2025-03-25 01:00:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02245766 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H20O2 |
|---|
| Molecular Mass | 268.1463 |
|---|
| SMILES | CC1CCC(c2ccc(O)cc2)C1c1ccc(O)cc1 |
|---|
| InChI Key | HAGTYBVWEWVVLC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | stilbenes |
|---|
| Subclass | stilbenes |
|---|
| Direct Parent | stilbenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzene and substituted derivativeshydrocarbon derivativesorganooxygen compounds |
|---|
| Substituents | aromatic homomonocyclic compoundmonocyclic benzene moietyorganic oxygen compound1-hydroxy-2-unsubstituted benzenoidphenolhydrocarbon derivativebenzenoidorganooxygen compoundstilbene |
|---|