| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:19:28 UTC |
|---|
| Update Date | 2025-03-25 01:00:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02245908 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C34H42O21 |
|---|
| Molecular Mass | 786.2219 |
|---|
| SMILES | CC1OC(OCC2C(O)C(O)C(O)C(OCC3OC(Oc4c(-c5ccc(O)c(O)c5)oc5cc(O)cc(O)c5c4=O)C(O)C(O)C3O)C2O)C(O)C(O)C1O |
|---|
| InChI Key | IJVIXXGIEVZPLM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavonoid glycosides |
|---|
| Direct Parent | flavonoid-3-o-glycosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3'-hydroxyflavonoids4'-hydroxyflavonoids5-hydroxyflavonoids7-hydroxyflavonoidsacetalsbenzene and substituted derivativeschromonescyclitols and derivativescyclohexanolsdialkyl ethersflavonoidsheteroaromatic compoundshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanespyranones and derivativesvinylogous acids |
|---|
| Substituents | monocyclic benzene moietyether1-benzopyran1-hydroxy-2-unsubstituted benzenoidmonosaccharidedialkyl ethersaccharideorganic oxideacetalchromonearomatic heteropolycyclic compoundflavonoid-3-o-glycosidepyranoneoxaneorganoheterocyclic compoundalcoholbenzopyranheteroaromatic compoundcyclohexanol5-hydroxyflavonoidcyclitol or derivatives1-hydroxy-4-unsubstituted benzenoidcyclic alcohol3'-hydroxyflavonoidoxacyclevinylogous acidorganic oxygen compoundpyran7-hydroxyflavonoidsecondary alcohol4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|