| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:19:32 UTC |
|---|
| Update Date | 2025-03-25 01:00:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02246058 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H7NO7S |
|---|
| Molecular Mass | 224.9943 |
|---|
| SMILES | CC1OC(=O)NC(=O)C1OS(=O)(=O)O |
|---|
| InChI Key | WHEJSNSEUITKIP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | sulfuric acid esters |
|---|
| Direct Parent | sulfuric acid monoesters |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-oxazinanesalkyl sulfatesazacyclic compoundscarbamate esterscarbonyl compoundscarboxylic acids and derivativesdicarboximideshydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compounds |
|---|
| Substituents | sulfuric acid monoestercarbonyl groupcarbonic acid derivativeazacycle1,3-oxazinanecarbamic acid estercarboxylic acid derivativeoxazinaneoxacycleorganic oxideorganic oxygen compoundalkyl sulfatealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundsulfate-esterhydrocarbon derivativedicarboximideorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compound |
|---|
