| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:19:34 UTC |
|---|
| Update Date | 2025-03-25 01:00:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02246107 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H14O8 |
|---|
| Molecular Mass | 262.0689 |
|---|
| SMILES | CC1OC(OC(=O)C=CC(=O)O)C(O)C(O)C1O |
|---|
| InChI Key | PLIQPHGTNHEWMT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acids and conjugates |
|---|
| Direct Parent | heterocyclic fatty acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesenoate estersfatty acid estershydrocarbon derivativeshydroxy fatty acidsmonosaccharidesorganic oxidesoxacyclic compoundsoxanessecondary alcoholsshort-chain hydroxy acids and derivativesunsaturated fatty acids |
|---|
| Substituents | carbonyl groupcarboxylic acidshort-chain hydroxy acidheterocyclic fatty acidmonosaccharidecarboxylic acid derivativealpha,beta-unsaturated carboxylic esterunsaturated fatty acidsaccharideorganic oxideacetalaliphatic heteromonocyclic compoundhydroxy fatty acidoxaneorganoheterocyclic compoundenoate esteralcoholoxacyclefatty acid esterorganic oxygen compoundcarboxylic acid estersecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativeorganooxygen compound |
|---|
