| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:19:35 UTC |
|---|
| Update Date | 2025-03-25 01:00:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02246175 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H26O4 |
|---|
| Molecular Mass | 318.1831 |
|---|
| SMILES | CC12CCC3C4CCC(=O)C=C4CCC3C1CCC2(O)C(=O)O |
|---|
| InChI Key | CGEWLVBEAZXNFU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | steroids and steroid derivatives |
|---|
| Subclass | hydroxysteroids |
|---|
| Direct Parent | 17-hydroxysteroids |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | 3-oxo delta-4-steroidsalpha hydroxy acids and derivativescarboxylic acidscyclic alcohols and derivativescyclohexenonesdelta-4-steroidsestrogens and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidestertiary alcohols |
|---|
| Substituents | cyclohexenonecarbonyl groupcarboxylic acidalpha-hydroxy acidcyclic ketonecarboxylic acid derivativealiphatic homopolycyclic compoundketoneorganic oxide17-hydroxysteroidestrogen-skeletonalcoholoxosteroiddelta-4-steroidestrane-skeleton3-oxo-delta-4-steroidhydroxy acidcyclic alcoholtertiary alcoholmonocarboxylic acid or derivativesorganic oxygen compound3-oxosteroidhydrocarbon derivativeorganooxygen compound |
|---|
